C21H14Cl2N8O3S — CID 149301473
2-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5-phenyldiazenylbenzenesulfonic acid (PubChem CID 149301473) has the molecular formula C21H14Cl2N8O3S and a molecular weight of 529.37 g/mol. Its IUPAC name is 2-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5-phenyldiazenylbenzenesulfonic acid.
| Compound Name | 2-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5-phenyldiazenylbenzenesulfonic acid |
|---|---|
| PubChem CID | 149301473 |
| Molecular Formula | C21H14Cl2N8O3S |
| Molecular Weight | 529.37 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 2-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5-phenyldiazenylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(/N=N/c2ccccc2)ccc1/N=N/c1ccc(Nc2nc(Cl)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C21H14Cl2N8O3S/c22-19-25-20(23)27-21(26-19)24-13-6-8-15(9-7-13)29-31-17-11-10-16(12-18(17)35(32,33)34)30-28-14-4-2-1-3-5-14/h1-12H,(H,32,33,34)(H,24,25,26,27)/b30-28+,31-29+ |
| InChIKey | XWVKXAQIUDIFOJ-FUEWEDNTSA-N |
| XLogP | 7.00 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.37 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|