C26H20ClN9O9S3 — CID 102240210
7-[[4-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,3,5-trisulfonic acid (PubChem CID 102240210) has the molecular formula C26H20ClN9O9S3 and a molecular weight of 734.15 g/mol. Its IUPAC name is 7-[[4-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,3,5-trisulfonic acid.
| Compound Name | 7-[[4-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 102240210 |
| Molecular Formula | C26H20ClN9O9S3 |
| Molecular Weight | 734.15 g/mol |
| Exact Mass | 733.02 |
| IUPAC Name | 7-[[4-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-2-methylphenyl]diazenyl]naphthalene-1,3,5-trisulfonic acid |
| SMILES | Cc1cc(/N=N/c2ccc(Nc3nc(N)nc(Cl)n3)cc2)ccc1/N=N/c1cc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C26H20ClN9O9S3/c1-13-8-16(34-33-15-4-2-14(3-5-15)29-26-31-24(27)30-25(28)32-26)6-7-21(13)36-35-17-9-19-20(22(10-17)47(40,41)42)11-18(46(37,38)39)12-23(19)48(43,44)45/h2-12H,1H3,(H,37,38,39)(H,40,41,42)(H,43,44,45)(H3,28,29,30,31,32)/b34-33+,36-35+ |
| InChIKey | XDXZUOFNYHIOHM-WXBFSDFVSA-N |
| XLogP | 5.88 |
| TPSA | 289.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.15 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|