C29H23Br2ClN8O7S2 — CID 90368939
7-[[4-[[4-chloro-6-[3-(2,3-dibromopropanoylamino)anilino]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 90368939) has the molecular formula C29H23Br2ClN8O7S2 and a molecular weight of 854.95 g/mol. Its IUPAC name is 7-[[4-[[4-chloro-6-[3-(2,3-dibromopropanoylamino)anilino]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[4-[[4-chloro-6-[3-(2,3-dibromopropanoylamino)anilino]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 90368939 |
| Molecular Formula | C29H23Br2ClN8O7S2 |
| Molecular Weight | 854.95 g/mol |
| Exact Mass | 851.92 |
| IUPAC Name | 7-[[4-[[4-chloro-6-[3-(2,3-dibromopropanoylamino)anilino]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | Cc1cc(Nc2nc(Cl)nc(Nc3cccc(NC(=O)C(Br)CBr)c3)n2)ccc1/N=N/c1ccc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C29H23Br2ClN8O7S2/c1-15-9-19(35-29-37-27(32)36-28(38-29)34-18-4-2-3-17(11-18)33-26(41)23(31)14-30)7-8-24(15)40-39-20-6-5-16-10-21(48(42,43)44)13-25(22(16)12-20)49(45,46)47/h2-13,23H,14H2,1H3,(H,33,41)(H,42,43,44)(H,45,46,47)(H2,34,35,36,37,38)/b40-39+ |
| InChIKey | WJIVXGSDNRFUJQ-XQQUEIPISA-N |
| XLogP | 7.48 |
| TPSA | 225.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.95 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|