C33H25ClN10O10S3 — CID 89179363
7-[[4-[[4-[[4-chloro-6-[3-(methylcarbamoyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3,5-trisulfonic acid (PubChem CID 89179363) has the molecular formula C33H25ClN10O10S3 and a molecular weight of 853.28 g/mol. Its IUPAC name is 7-[[4-[[4-[[4-chloro-6-[3-(methylcarbamoyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3,5-trisulfonic acid.
| Compound Name | 7-[[4-[[4-[[4-chloro-6-[3-(methylcarbamoyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 89179363 |
| Molecular Formula | C33H25ClN10O10S3 |
| Molecular Weight | 853.28 g/mol |
| Exact Mass | 852.06 |
| IUPAC Name | 7-[[4-[[4-[[4-chloro-6-[3-(methylcarbamoyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3,5-trisulfonic acid |
| SMILES | CNC(=O)c1cccc(Nc2nc(Cl)nc(Nc3ccc(/N=N/c4ccc(/N=N/c5cc(S(=O)(=O)O)c6cc(S(=O)(=O)O)cc(S(=O)(=O)O)c6c5)cc4)cc3)n2)c1 |
| InChI | InChI=1S/C33H25ClN10O10S3/c1-35-30(45)18-3-2-4-23(13-18)37-33-39-31(34)38-32(40-33)36-19-5-7-20(8-6-19)41-42-21-9-11-22(12-10-21)43-44-24-14-26-27(28(15-24)56(49,50)51)16-25(55(46,47)48)17-29(26)57(52,53)54/h2-17H,1H3,(H,35,45)(H,46,47,48)(H,49,50,51)(H,52,53,54)(H2,36,37,38,39,40)/b42-41+,44-43+ |
| InChIKey | PUCHHGHYIVSIGL-PSLWYDSHSA-N |
| XLogP | 7.10 |
| TPSA | 304.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.28 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|