C33H28N10O15S5 — CID 88849994
3-[[4-[[4-(1-sulfoethylamino)-6-[2-sulfo-4-[(4-sulfophenyl)diazenyl]anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 88849994) has the molecular formula C33H28N10O15S5 and a molecular weight of 964.98 g/mol. Its IUPAC name is 3-[[4-[[4-(1-sulfoethylamino)-6-[2-sulfo-4-[(4-sulfophenyl)diazenyl]anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[[4-(1-sulfoethylamino)-6-[2-sulfo-4-[(4-sulfophenyl)diazenyl]anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 88849994 |
| Molecular Formula | C33H28N10O15S5 |
| Molecular Weight | 964.98 g/mol |
| Exact Mass | 964.03 |
| IUPAC Name | 3-[[4-[[4-(1-sulfoethylamino)-6-[2-sulfo-4-[(4-sulfophenyl)diazenyl]anilino]-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | CC(Nc1nc(Nc2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)cc2)nc(Nc2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2S(=O)(=O)O)n1)S(=O)(=O)O |
| InChI | InChI=1S/C33H28N10O15S5/c1-18(59(44,45)46)34-31-37-32(39-33(38-31)36-27-14-11-22(16-30(27)63(56,57)58)42-40-21-9-12-24(13-10-21)60(47,48)49)35-19-5-7-20(8-6-19)41-43-23-15-26-25(29(17-23)62(53,54)55)3-2-4-28(26)61(50,51)52/h2-18H,1H3,(H,44,45,46)(H,47,48,49)(H,50,51,52)(H,53,54,55)(H,56,57,58)(H3,34,35,36,37,38,39)/b42-40+,43-41+ |
| InChIKey | UYCJGXGFWFODCC-IZRQRQPJSA-N |
| XLogP | 5.98 |
| TPSA | 396.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.98 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|