C33H34N10O11S3 — CID 89039875
3-[[3-methoxy-4-[[4-[4-phenyldiazenyl-2-(3-sulfopropoxy)anilino]-6-(1-sulfoethylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 89039875) has the molecular formula C33H34N10O11S3 and a molecular weight of 842.89 g/mol. Its IUPAC name is 3-[[3-methoxy-4-[[4-[4-phenyldiazenyl-2-(3-sulfopropoxy)anilino]-6-(1-sulfoethylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 3-[[3-methoxy-4-[[4-[4-phenyldiazenyl-2-(3-sulfopropoxy)anilino]-6-(1-sulfoethylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89039875 |
| Molecular Formula | C33H34N10O11S3 |
| Molecular Weight | 842.89 g/mol |
| Exact Mass | 842.16 |
| IUPAC Name | 3-[[3-methoxy-4-[[4-[4-phenyldiazenyl-2-(3-sulfopropoxy)anilino]-6-(1-sulfoethylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2cccc(S(=O)(=O)O)c2)ccc1Nc1nc(Nc2ccc(/N=N/c3ccccc3)cc2OCCCS(=O)(=O)O)nc(NC(C)S(=O)(=O)O)n1 |
| InChI | InChI=1S/C33H34N10O11S3/c1-21(56(47,48)49)34-31-37-32(35-27-14-12-24(19-29(27)53-2)43-41-23-10-6-11-26(18-23)57(50,51)52)39-33(38-31)36-28-15-13-25(42-40-22-8-4-3-5-9-22)20-30(28)54-16-7-17-55(44,45)46/h3-6,8-15,18-21H,7,16-17H2,1-2H3,(H,44,45,46)(H,47,48,49)(H,50,51,52)(H3,34,35,36,37,38,39)/b42-40+,43-41+ |
| InChIKey | MHRZPHDKCDPIAD-IZRQRQPJSA-N |
| XLogP | 6.75 |
| TPSA | 305.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.89 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|