C34H36N10O7S — CID 58773737
4-[[4-[[4-[bis(2-hydroxyethyl)amino]-6-[2-methoxy-4-[(4-methylphenyl)diazenyl]anilino]-1,3,5-triazin-2-yl]amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid (PubChem CID 58773737) has the molecular formula C34H36N10O7S and a molecular weight of 728.79 g/mol. Its IUPAC name is 4-[[4-[[4-[bis(2-hydroxyethyl)amino]-6-[2-methoxy-4-[(4-methylphenyl)diazenyl]anilino]-1,3,5-triazin-2-yl]amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[4-[[4-[bis(2-hydroxyethyl)amino]-6-[2-methoxy-4-[(4-methylphenyl)diazenyl]anilino]-1,3,5-triazin-2-yl]amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58773737 |
| Molecular Formula | C34H36N10O7S |
| Molecular Weight | 728.79 g/mol |
| Exact Mass | 728.25 |
| IUPAC Name | 4-[[4-[[4-[bis(2-hydroxyethyl)amino]-6-[2-methoxy-4-[(4-methylphenyl)diazenyl]anilino]-1,3,5-triazin-2-yl]amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(C)cc2)ccc1Nc1nc(Nc2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2OC)nc(N(CCO)CCO)n1 |
| InChI | InChI=1S/C34H36N10O7S/c1-22-4-6-23(7-5-22)40-42-25-10-14-28(30(20-25)50-2)35-32-37-33(39-34(38-32)44(16-18-45)17-19-46)36-29-15-11-26(21-31(29)51-3)43-41-24-8-12-27(13-9-24)52(47,48)49/h4-15,20-21,45-46H,16-19H2,1-3H3,(H,47,48,49)(H2,35,36,37,38,39)/b42-40+,43-41+ |
| InChIKey | VYPZEVNAWYEAAL-IZRQRQPJSA-N |
| XLogP | 6.55 |
| TPSA | 228.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.79 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|