C26H29N7O9S2 — CID 135708106
4-[[4-[bis(2-hydroxyethyl)amino]-6-methyl-1,3,5-triazin-2-yl]amino]-5-hydroxy-7-methyl-6-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135708106) has the molecular formula C26H29N7O9S2 and a molecular weight of 647.69 g/mol. Its IUPAC name is 4-[[4-[bis(2-hydroxyethyl)amino]-6-methyl-1,3,5-triazin-2-yl]amino]-5-hydroxy-7-methyl-6-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-[[4-[bis(2-hydroxyethyl)amino]-6-methyl-1,3,5-triazin-2-yl]amino]-5-hydroxy-7-methyl-6-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135708106 |
| Molecular Formula | C26H29N7O9S2 |
| Molecular Weight | 647.69 g/mol |
| Exact Mass | 647.15 |
| IUPAC Name | 4-[[4-[bis(2-hydroxyethyl)amino]-6-methyl-1,3,5-triazin-2-yl]amino]-5-hydroxy-7-methyl-6-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2c(C)cc3cc(S(=O)(=O)O)cc(Nc4nc(C)nc(N(CCO)CCO)n4)c3c2O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C26H29N7O9S2/c1-14-4-5-19(21(10-14)44(40,41)42)31-32-23-15(2)11-17-12-18(43(37,38)39)13-20(22(17)24(23)36)29-25-27-16(3)28-26(30-25)33(6-8-34)7-9-35/h4-5,10-13,34-36H,6-9H2,1-3H3,(H,37,38,39)(H,40,41,42)(H,27,28,29,30)/b32-31+ |
| InChIKey | XCSDKXDJDDEZAD-QNEJGDQOSA-N |
| XLogP | 3.10 |
| TPSA | 248.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.69 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|