C27H26N8O11S3 — CID 135787835
5-[[4-(ethylamino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 135787835) has the molecular formula C27H26N8O11S3 and a molecular weight of 734.75 g/mol. Its IUPAC name is 5-[[4-(ethylamino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-[[4-(ethylamino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135787835 |
| Molecular Formula | C27H26N8O11S3 |
| Molecular Weight | 734.75 g/mol |
| Exact Mass | 734.09 |
| IUPAC Name | 5-[[4-(ethylamino)-6-(2-hydroxyethylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | CCNc1nc(NCCO)nc(Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc5ccccc5c4S(=O)(=O)O)c(O)c23)n1 |
| InChI | InChI=1S/C27H26N8O11S3/c1-2-28-25-31-26(29-9-10-36)33-27(32-25)30-19-13-16(47(38,39)40)11-15-12-20(48(41,42)43)22(23(37)21(15)19)35-34-18-8-7-14-5-3-4-6-17(14)24(18)49(44,45)46/h3-8,11-13,36-37H,2,9-10H2,1H3,(H,38,39,40)(H,41,42,43)(H,44,45,46)(H3,28,29,30,31,32,33)/b35-34+ |
| InChIKey | JLOJLIBQLCCQDQ-XAHDOWKMSA-N |
| XLogP | 3.62 |
| TPSA | 303.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|