C27H25N7O12S3 — CID 135997814
5-hydroxy-4-[(4-morpholin-4-yl-6-oxo-1H-1,3,5-triazin-2-yl)amino]-6-[(1-sulfonaphthalen-2-yl)diazenyl]-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135997814) has the molecular formula C27H25N7O12S3 and a molecular weight of 735.74 g/mol. Its IUPAC name is 5-hydroxy-4-[(4-morpholin-4-yl-6-oxo-1H-1,3,5-triazin-2-yl)amino]-6-[(1-sulfonaphthalen-2-yl)diazenyl]-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 5-hydroxy-4-[(4-morpholin-4-yl-6-oxo-1H-1,3,5-triazin-2-yl)amino]-6-[(1-sulfonaphthalen-2-yl)diazenyl]-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135997814 |
| Molecular Formula | C27H25N7O12S3 |
| Molecular Weight | 735.74 g/mol |
| Exact Mass | 735.07 |
| IUPAC Name | 5-hydroxy-4-[(4-morpholin-4-yl-6-oxo-1H-1,3,5-triazin-2-yl)amino]-6-[(1-sulfonaphthalen-2-yl)diazenyl]-7-(trihydroxy-λ4-sulfanyl)naphthalene-2-sulfonic acid |
| SMILES | O=c1nc(N2CCOCC2)nc(Nc2cc(S(=O)(=O)O)cc3cc(S(O)(O)O)c(/N=N/c4ccc5ccccc5c4S(=O)(=O)O)c(O)c23)[nH]1 |
| InChI | InChI=1S/C27H25N7O12S3/c35-23-21-15(11-16(47(37,38)39)13-19(21)28-25-29-26(31-27(36)30-25)34-7-9-46-10-8-34)12-20(48(40,41)42)22(23)33-32-18-6-5-14-3-1-2-4-17(14)24(18)49(43,44)45/h1-6,11-13,35,40-42H,7-10H2,(H,37,38,39)(H,43,44,45)(H2,28,29,30,31,36)/b33-32+ |
| InChIKey | IEQUAYSFGABJEE-ULIFNZDWSA-N |
| XLogP | 4.25 |
| TPSA | 297.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|