C24H26N8O12S3 — CID 142080263
3-[(5-amino-2-sulfophenyl)diazenyl]-5-[(4-morpholin-4-yl-6-oxo-1H-1,3,5-triazin-2-yl)amino]naphthalene-2,7-disulfonic acid;methanol (PubChem CID 142080263) has the molecular formula C24H26N8O12S3 and a molecular weight of 714.72 g/mol. Its IUPAC name is 3-[(5-amino-2-sulfophenyl)diazenyl]-5-[(4-morpholin-4-yl-6-oxo-1H-1,3,5-triazin-2-yl)amino]naphthalene-2,7-disulfonic acid;methanol.
| Compound Name | 3-[(5-amino-2-sulfophenyl)diazenyl]-5-[(4-morpholin-4-yl-6-oxo-1H-1,3,5-triazin-2-yl)amino]naphthalene-2,7-disulfonic acid;methanol |
|---|---|
| PubChem CID | 142080263 |
| Molecular Formula | C24H26N8O12S3 |
| Molecular Weight | 714.72 g/mol |
| Exact Mass | 714.08 |
| IUPAC Name | 3-[(5-amino-2-sulfophenyl)diazenyl]-5-[(4-morpholin-4-yl-6-oxo-1H-1,3,5-triazin-2-yl)amino]naphthalene-2,7-disulfonic acid;methanol |
| SMILES | CO.Nc1ccc(S(=O)(=O)O)c(/N=N/c2cc3c(Nc4nc(N5CCOCC5)nc(=O)[nH]4)cc(S(=O)(=O)O)cc3cc2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C23H22N8O11S3.CH4O/c24-13-1-2-19(44(36,37)38)17(9-13)29-30-18-11-15-12(8-20(18)45(39,40)41)7-14(43(33,34)35)10-16(15)25-21-26-22(28-23(32)27-21)31-3-5-42-6-4-31;1-2/h1-2,7-11H,3-6,24H2,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H2,25,26,27,28,32);2H,1H3/b30-29+; |
| InChIKey | MIKFFGWEFLVPRO-BXGDTPBJSA-N |
| XLogP | 1.24 |
| TPSA | 317.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|