C19H23N7O7S2 — CID 59310172
4-[[4-(2-aminoethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-5-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 59310172) has the molecular formula C19H23N7O7S2 and a molecular weight of 525.57 g/mol. Its IUPAC name is 4-[[4-(2-aminoethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-5-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 4-[[4-(2-aminoethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-5-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 59310172 |
| Molecular Formula | C19H23N7O7S2 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 4-[[4-(2-aminoethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-5-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | NCCNc1nc(Nc2cc(S(=O)(=O)O)cc3cccc(SOOO)c23)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H23N7O7S2/c20-4-5-21-17-23-18(25-19(24-17)26-6-8-31-9-7-26)22-14-11-13(35(28,29)30)10-12-2-1-3-15(16(12)14)34-33-32-27/h1-3,10-11,27H,4-9,20H2,(H,28,29,30)(H2,21,22,23,24,25) |
| InChIKey | SATHYHCCFMDDTJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 194.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|