C18H24N7O9S2- — CID 54305948
4-[4-(2-carboxy-5-sulfoanilino)-6-[2-hydroxyethyl-[2-(sulfinatoamino)ethyl]amino]-1,3,5-triazin-2-yl]morpholine (PubChem CID 54305948) has the molecular formula C18H24N7O9S2- and a molecular weight of 546.56 g/mol. Its IUPAC name is 4-[4-(2-carboxy-5-sulfoanilino)-6-[2-hydroxyethyl-[2-(sulfinatoamino)ethyl]amino]-1,3,5-triazin-2-yl]morpholine.
| Compound Name | 4-[4-(2-carboxy-5-sulfoanilino)-6-[2-hydroxyethyl-[2-(sulfinatoamino)ethyl]amino]-1,3,5-triazin-2-yl]morpholine |
|---|---|
| PubChem CID | 54305948 |
| Molecular Formula | C18H24N7O9S2- |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 4-[4-(2-carboxy-5-sulfoanilino)-6-[2-hydroxyethyl-[2-(sulfinatoamino)ethyl]amino]-1,3,5-triazin-2-yl]morpholine |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cc1Nc1nc(N(CCO)CCNS(=O)[O-])nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H25N7O9S2/c26-8-5-24(4-3-19-35(29)30)17-21-16(22-18(23-17)25-6-9-34-10-7-25)20-14-11-12(36(31,32)33)1-2-13(14)15(27)28/h1-2,11,19,26H,3-10H2,(H,27,28)(H,29,30)(H,31,32,33)(H,20,21,22,23)/p-1 |
| InChIKey | YRSALYVHNFYQFP-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 230.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|