C33H26N8O7S4 — CID 57473538
3-(1,3-benzothiazol-2-yl)-4-[[4-[2-(1,3-benzothiazol-2-yl)-4-sulfoanilino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 57473538) has the molecular formula C33H26N8O7S4 and a molecular weight of 774.89 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4-[[4-[2-(1,3-benzothiazol-2-yl)-4-sulfoanilino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4-[[4-[2-(1,3-benzothiazol-2-yl)-4-sulfoanilino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 57473538 |
| Molecular Formula | C33H26N8O7S4 |
| Molecular Weight | 774.89 g/mol |
| Exact Mass | 774.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4-[[4-[2-(1,3-benzothiazol-2-yl)-4-sulfoanilino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Nc2nc(Nc3ccc(S(=O)(=O)O)cc3-c3nc4ccccc4s3)nc(N3CCOCC3)n2)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C33H26N8O7S4/c42-51(43,44)19-9-11-23(21(17-19)29-34-25-5-1-3-7-27(25)49-29)36-31-38-32(40-33(39-31)41-13-15-48-16-14-41)37-24-12-10-20(52(45,46)47)18-22(24)30-35-26-6-2-4-8-28(26)50-30/h1-12,17-18H,13-16H2,(H,42,43,44)(H,45,46,47)(H2,36,37,38,39,40) |
| InChIKey | PCIWBJWCSKZPGR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 209.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.89 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|