C16H25N7O10S3 — CID 59664361
3-[[4-[bis(2-hydroxyethyl)amino]-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid (PubChem CID 59664361) has the molecular formula C16H25N7O10S3 and a molecular weight of 571.62 g/mol. Its IUPAC name is 3-[[4-[bis(2-hydroxyethyl)amino]-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid.
| Compound Name | 3-[[4-[bis(2-hydroxyethyl)amino]-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid |
|---|---|
| PubChem CID | 59664361 |
| Molecular Formula | C16H25N7O10S3 |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | 3-[[4-[bis(2-hydroxyethyl)amino]-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid |
| SMILES | CS(=O)(=O)NCCNc1nc(Nc2cc(S(=O)(=O)O)ccc2OS(=O)O)nc(N(CCO)CCO)n1 |
| InChI | InChI=1S/C16H25N7O10S3/c1-35(28,29)18-5-4-17-14-20-15(22-16(21-14)23(6-8-24)7-9-25)19-12-10-11(36(30,31)32)2-3-13(12)33-34(26)27/h2-3,10,18,24-25H,4-9H2,1H3,(H,26,27)(H,30,31,32)(H2,17,19,20,21,22) |
| InChIKey | QZJMABRMXAVZCY-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 253.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|