C15H15N7O6S2 — CID 59787554
3-[[4-amino-6-(3-aminoanilino)-1,3,5-triazin-2-yl]amino]-4-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 59787554) has the molecular formula C15H15N7O6S2 and a molecular weight of 453.46 g/mol. Its IUPAC name is 3-[[4-amino-6-(3-aminoanilino)-1,3,5-triazin-2-yl]amino]-4-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 3-[[4-amino-6-(3-aminoanilino)-1,3,5-triazin-2-yl]amino]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 59787554 |
| Molecular Formula | C15H15N7O6S2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 3-[[4-amino-6-(3-aminoanilino)-1,3,5-triazin-2-yl]amino]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | Nc1cccc(Nc2nc(N)nc(Nc3cc(S(=O)(=O)O)ccc3SOOO)n2)c1 |
| InChI | InChI=1S/C15H15N7O6S2/c16-8-2-1-3-9(6-8)18-14-20-13(17)21-15(22-14)19-11-7-10(30(24,25)26)4-5-12(11)29-28-27-23/h1-7,23H,16H2,(H,24,25,26)(H4,17,18,19,20,21,22) |
| InChIKey | XHOAJCRPDUCCAC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 207.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|