C20H16Cl2N10O6S2 — CID 58912173
5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-(trioxidanylsulfanyl)phenyl]ethenyl]benzenesulfonic acid (PubChem CID 58912173) has the molecular formula C20H16Cl2N10O6S2 and a molecular weight of 627.45 g/mol. Its IUPAC name is 5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-(trioxidanylsulfanyl)phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-(trioxidanylsulfanyl)phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58912173 |
| Molecular Formula | C20H16Cl2N10O6S2 |
| Molecular Weight | 627.45 g/mol |
| Exact Mass | 626.01 |
| IUPAC Name | 5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-(trioxidanylsulfanyl)phenyl]ethenyl]benzenesulfonic acid |
| SMILES | Nc1nc(Cl)nc(Nc2ccc(/C=C/c3ccc(Nc4nc(N)nc(Cl)n4)cc3S(=O)(=O)O)c(SOOO)c2)n1 |
| InChI | InChI=1S/C20H16Cl2N10O6S2/c21-15-27-17(23)31-19(29-15)25-11-5-3-9(13(7-11)39-38-37-33)1-2-10-4-6-12(8-14(10)40(34,35)36)26-20-30-16(22)28-18(24)32-20/h1-8,33H,(H,34,35,36)(H3,23,25,27,29,31)(H3,24,26,28,30,32)/b2-1+ |
| InChIKey | NMJUSFOMJFUGFU-OWOJBTEDSA-N |
| XLogP | 3.86 |
| TPSA | 246.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|