C34H28B2N8O6S2 — CID 59985975
CID 59985975 (PubChem CID 59985975) has the molecular formula C34H28B2N8O6S2 and a molecular weight of 730.41 g/mol.
| Compound Name | CID 59985975 |
|---|---|
| PubChem CID | 59985975 |
| Molecular Formula | C34H28B2N8O6S2 |
| Molecular Weight | 730.41 g/mol |
| Exact Mass | 730.18 |
| IUPAC Name | — |
| SMILES | Cc1nc([B]c2ccccc2)nc(Nc2ccc(/C=C/c3ccc(Nc4nc(C)nc([B]c5ccccc5)n4)cc3S(=O)(=O)O)c(SOOO)c2)n1 |
| InChI | InChI=1S/C34H28B2N8O6S2/c1-21-37-31(35-25-9-5-3-6-10-25)43-33(39-21)41-27-17-15-23(29(19-27)51-50-49-45)13-14-24-16-18-28(20-30(24)52(46,47)48)42-34-40-22(2)38-32(44-34)36-26-11-7-4-8-12-26/h3-20,45H,1-2H3,(H,46,47,48)(H,37,39,41,43)(H,38,40,42,44)/b14-13+ |
| InChIKey | BBLISQMXSJALDP-BUHFOSPRSA-N |
| XLogP | 3.32 |
| TPSA | 194.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|