C44H32N8O10S2 — CID 72730170
5-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]-2-[2-[4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 72730170) has the molecular formula C44H32N8O10S2 and a molecular weight of 896.92 g/mol. Its IUPAC name is 5-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]-2-[2-[4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]-2-[2-[4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 72730170 |
| Molecular Formula | C44H32N8O10S2 |
| Molecular Weight | 896.92 g/mol |
| Exact Mass | 896.17 |
| IUPAC Name | 5-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]-2-[2-[4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(Oc3ccccc3)nc(Oc3ccccc3)n2)ccc1C=Cc1ccc(Nc2nc(Oc3ccccc3)nc(Oc3ccccc3)n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C44H32N8O10S2/c53-63(54,55)37-27-31(45-39-47-41(59-33-13-5-1-6-14-33)51-42(48-39)60-34-15-7-2-8-16-34)25-23-29(37)21-22-30-24-26-32(28-38(30)64(56,57)58)46-40-49-43(61-35-17-9-3-10-18-35)52-44(50-40)62-36-19-11-4-12-20-36/h1-28H,(H,53,54,55)(H,56,57,58)(H,45,47,48,51)(H,46,49,50,52) |
| InChIKey | HSCJDRIMEXIREO-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 247.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.92 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|