C34H30N10O8S2 — CID 154944216
5-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]phenyl]sulfonyloxyethenyl]benzenesulfonic acid (PubChem CID 154944216) has the molecular formula C34H30N10O8S2 and a molecular weight of 770.81 g/mol. Its IUPAC name is 5-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]phenyl]sulfonyloxyethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]phenyl]sulfonyloxyethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 154944216 |
| Molecular Formula | C34H30N10O8S2 |
| Molecular Weight | 770.81 g/mol |
| Exact Mass | 770.17 |
| IUPAC Name | 5-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]phenyl]sulfonyloxyethenyl]benzenesulfonic acid |
| SMILES | COc1nc(Nc2ccccc2)nc(Nc2ccc(S(=O)(=O)O/C=C/c3ccc(Nc4nc(Nc5ccccc5)nc(OC)n4)cc3S(=O)(=O)O)cc2)n1 |
| InChI | InChI=1S/C34H30N10O8S2/c1-50-33-41-29(35-23-9-5-3-6-10-23)39-31(43-33)37-25-15-17-27(18-16-25)54(48,49)52-20-19-22-13-14-26(21-28(22)53(45,46)47)38-32-40-30(42-34(44-32)51-2)36-24-11-7-4-8-12-24/h3-21H,1-2H3,(H,45,46,47)(H2,35,37,39,41,43)(H2,36,38,40,42,44)/b20-19+ |
| InChIKey | DQFRZIZOVIGQPH-FMQUCBEESA-N |
| XLogP | 5.67 |
| TPSA | 241.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.81 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|