C36H36N12NaO8S2 — CID 166600387
C.I. Fluorescent Brightener 85 (PubChem CID 166600387) has the molecular formula C36H36N12NaO8S2 and a molecular weight of 851.88 g/mol.
| Compound Name | C.I. Fluorescent Brightener 85 |
|---|---|
| PubChem CID | 166600387 |
| Molecular Formula | C36H36N12NaO8S2 |
| Molecular Weight | 851.88 g/mol |
| Exact Mass | 851.21 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(NCCO)nc(Nc3ccccc3)n2)ccc1/C=C/c1ccc(Nc2nc(NCCO)nc(Nc3ccccc3)n2)cc1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C36H36N12O8S2.Na/c49-19-17-37-31-43-33(39-25-7-3-1-4-8-25)47-35(45-31)41-27-15-13-23(29(21-27)57(51,52)53)11-12-24-14-16-28(22-30(24)58(54,55)56)42-36-46-32(38-18-20-50)44-34(48-36)40-26-9-5-2-6-10-26;/h1-16,21-22,49-50H,17-20H2,(H,51,52,53)(H,54,55,56)(H3,37,39,41,43,45,47)(H3,38,40,42,44,46,48);/b12-11+; |
| InChIKey | JOUITNXNXWKSLP-CALJPSDSSA-N |
| XLogP | 4.12 |
| TPSA | 298.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|