C29H27K2N9O9S2 — CID 173063141
CID 173063141 (PubChem CID 173063141) has the molecular formula C29H27K2N9O9S2 and a molecular weight of 787.92 g/mol.
| Compound Name | CID 173063141 |
|---|---|
| PubChem CID | 173063141 |
| Molecular Formula | C29H27K2N9O9S2 |
| Molecular Weight | 787.92 g/mol |
| Exact Mass | 787.06 |
| IUPAC Name | — |
| SMILES | COc1nc(Nc2ccccc2)nc(Nc2ccc(C=Cc3ccc(Nc4nc(OC)nc(OC)n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)n1.[K].[K] |
| InChI | InChI=1S/C29H27N9O9S2.2K/c1-45-27-34-24(30-19-7-5-4-6-8-19)33-25(35-27)31-20-13-11-17(22(15-20)48(39,40)41)9-10-18-12-14-21(16-23(18)49(42,43)44)32-26-36-28(46-2)38-29(37-26)47-3;;/h4-16H,1-3H3,(H,39,40,41)(H,42,43,44)(H,32,36,37,38)(H2,30,31,33,34,35);; |
| InChIKey | BLQIEBBLRBPVLY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 249.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|