C22H14Cl4N6O6S2 — CID 14716286
5-[(4,6-dichloropyrimidin-2-yl)amino]-2-[(E)-2-[4-[(4,6-dichloropyrimidin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 14716286) has the molecular formula C22H14Cl4N6O6S2 and a molecular weight of 664.34 g/mol. Its IUPAC name is 5-[(4,6-dichloropyrimidin-2-yl)amino]-2-[(E)-2-[4-[(4,6-dichloropyrimidin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4,6-dichloropyrimidin-2-yl)amino]-2-[(E)-2-[4-[(4,6-dichloropyrimidin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 14716286 |
| Molecular Formula | C22H14Cl4N6O6S2 |
| Molecular Weight | 664.34 g/mol |
| Exact Mass | 661.92 |
| IUPAC Name | 5-[(4,6-dichloropyrimidin-2-yl)amino]-2-[(E)-2-[4-[(4,6-dichloropyrimidin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(Cl)cc(Cl)n2)ccc1/C=C/c1ccc(Nc2nc(Cl)cc(Cl)n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C22H14Cl4N6O6S2/c23-17-9-18(24)30-21(29-17)27-13-5-3-11(15(7-13)39(33,34)35)1-2-12-4-6-14(8-16(12)40(36,37)38)28-22-31-19(25)10-20(26)32-22/h1-10H,(H,27,29,30)(H,28,31,32)(H,33,34,35)(H,36,37,38)/b2-1+ |
| InChIKey | AASJOKUWGNXIIQ-OWOJBTEDSA-N |
| XLogP | 6.03 |
| TPSA | 184.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.34 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|