C23H21N8O6S2Y- — CID 58708333
CID 58708333 (PubChem CID 58708333) has the molecular formula C23H21N8O6S2Y- and a molecular weight of 658.51 g/mol.
| Compound Name | CID 58708333 |
|---|---|
| PubChem CID | 58708333 |
| Molecular Formula | C23H21N8O6S2Y- |
| Molecular Weight | 658.51 g/mol |
| Exact Mass | 658.01 |
| IUPAC Name | — |
| SMILES | Cc1n[c-]nc(Nc2ccc(C=Cc3ccc(Nc4nc(C)nc(C)n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)n1.[Y] |
| InChI | InChI=1S/C23H21N8O6S2.Y/c1-13-24-12-25-22(27-13)30-18-8-6-16(20(10-18)38(32,33)34)4-5-17-7-9-19(11-21(17)39(35,36)37)31-23-28-14(2)26-15(3)29-23;/h4-11H,1-3H3,(H,32,33,34)(H,35,36,37)(H,24,25,27,30)(H,26,28,29,31);/q-1; |
| InChIKey | WDBICRSHHMNRPK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 210.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|