C35H30N8O6S2 — CID 58839520
2-[(E)-2-[4-[(4-benzyl-6-methyl-1,3,5-triazin-2-yl)amino]-2-(trioxidanylsulfanyl)phenyl]ethenyl]-5-[(4-benzyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid (PubChem CID 58839520) has the molecular formula C35H30N8O6S2 and a molecular weight of 722.81 g/mol. Its IUPAC name is 2-[(E)-2-[4-[(4-benzyl-6-methyl-1,3,5-triazin-2-yl)amino]-2-(trioxidanylsulfanyl)phenyl]ethenyl]-5-[(4-benzyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 2-[(E)-2-[4-[(4-benzyl-6-methyl-1,3,5-triazin-2-yl)amino]-2-(trioxidanylsulfanyl)phenyl]ethenyl]-5-[(4-benzyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 58839520 |
| Molecular Formula | C35H30N8O6S2 |
| Molecular Weight | 722.81 g/mol |
| Exact Mass | 722.17 |
| IUPAC Name | 2-[(E)-2-[4-[(4-benzyl-6-methyl-1,3,5-triazin-2-yl)amino]-2-(trioxidanylsulfanyl)phenyl]ethenyl]-5-[(4-benzyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
| SMILES | Cc1nc(Cc2ccccc2)nc(Nc2ccc(/C=C/c3ccc(Nc4ncnc(Cc5ccccc5)n4)cc3S(=O)(=O)O)c(SOOO)c2)n1 |
| InChI | InChI=1S/C35H30N8O6S2/c1-23-38-33(19-25-10-6-3-7-11-25)43-35(39-23)41-28-16-14-26(30(20-28)50-49-48-44)12-13-27-15-17-29(21-31(27)51(45,46)47)40-34-37-22-36-32(42-34)18-24-8-4-2-5-9-24/h2-17,20-22,44H,18-19H2,1H3,(H,45,46,47)(H,36,37,40,42)(H,38,39,41,43)/b13-12+ |
| InChIKey | CRZPKCQONMNPRR-OUKQBFOZSA-N |
| XLogP | 6.88 |
| TPSA | 194.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.81 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|