C35H26Cl2N8O5S — CID 157135060
4-[[4-[4-[(E)-2-[4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)methyl]phenyl]ethenyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]methyl]benzoic acid (PubChem CID 157135060) has the molecular formula C35H26Cl2N8O5S and a molecular weight of 741.62 g/mol. Its IUPAC name is 4-[[4-[4-[(E)-2-[4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)methyl]phenyl]ethenyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-[4-[(E)-2-[4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)methyl]phenyl]ethenyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 157135060 |
| Molecular Formula | C35H26Cl2N8O5S |
| Molecular Weight | 741.62 g/mol |
| Exact Mass | 740.11 |
| IUPAC Name | 4-[[4-[4-[(E)-2-[4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)methyl]phenyl]ethenyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cc2nc(Cl)nc(Nc3ccc(/C=C/c4ccc(Cc5nc(Cl)nc(Nc6ccccc6)n5)cc4)c(S(=O)(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C35H26Cl2N8O5S/c36-32-40-29(42-34(44-32)38-26-4-2-1-3-5-26)18-22-8-6-21(7-9-22)10-13-24-16-17-27(20-28(24)51(48,49)50)39-35-43-30(41-33(37)45-35)19-23-11-14-25(15-12-23)31(46)47/h1-17,20H,18-19H2,(H,46,47)(H,48,49,50)(H,38,40,42,44)(H,39,41,43,45)/b13-10+ |
| InChIKey | YMYMXNBIOPNURR-JLHYYAGUSA-N |
| XLogP | 7.15 |
| TPSA | 193.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.62 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|