C20H14Cl2N10Na2O6S2 — CID 15375405
disodium;5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate (PubChem CID 15375405) has the molecular formula C20H14Cl2N10Na2O6S2 and a molecular weight of 671.42 g/mol. Its IUPAC name is disodium;5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate.
| Compound Name | disodium;5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 15375405 |
| Molecular Formula | C20H14Cl2N10Na2O6S2 |
| Molecular Weight | 671.42 g/mol |
| Exact Mass | 669.97 |
| IUPAC Name | disodium;5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[(E)-2-[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
| SMILES | Nc1nc(Cl)nc(Nc2ccc(/C=C/c3ccc(Nc4nc(N)nc(Cl)n4)cc3S(=O)(=O)[O-])c(S(=O)(=O)[O-])c2)n1.[Na+].[Na+] |
| InChI | InChI=1S/C20H16Cl2N10O6S2.2Na/c21-15-27-17(23)31-19(29-15)25-11-5-3-9(13(7-11)39(33,34)35)1-2-10-4-6-12(8-14(10)40(36,37)38)26-20-30-16(22)28-18(24)32-20;;/h1-8H,(H,33,34,35)(H,36,37,38)(H3,23,25,27,29,31)(H3,24,26,28,30,32);;/q;2*+1/p-2/b2-1+;; |
| InChIKey | XVNSGDAQVWOVDW-SEPHDYHBSA-L |
| XLogP | -4.00 |
| TPSA | 267.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.42 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|