C19H13Cl2N5Na2O7S2 — CID 159105671
disodium;2-[2-(4-acetamido-2-sulfonatophenyl)ethenyl]-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate (PubChem CID 159105671) has the molecular formula C19H13Cl2N5Na2O7S2 and a molecular weight of 604.36 g/mol. Its IUPAC name is disodium;2-[2-(4-acetamido-2-sulfonatophenyl)ethenyl]-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate.
| Compound Name | disodium;2-[2-(4-acetamido-2-sulfonatophenyl)ethenyl]-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 159105671 |
| Molecular Formula | C19H13Cl2N5Na2O7S2 |
| Molecular Weight | 604.36 g/mol |
| Exact Mass | 602.94 |
| IUPAC Name | disodium;2-[2-(4-acetamido-2-sulfonatophenyl)ethenyl]-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate |
| SMILES | CC(=O)Nc1ccc(C=Cc2ccc(Nc3nc(Cl)nc(Cl)n3)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C19H15Cl2N5O7S2.2Na/c1-10(27)22-13-6-4-11(15(8-13)34(28,29)30)2-3-12-5-7-14(9-16(12)35(31,32)33)23-19-25-17(20)24-18(21)26-19;;/h2-9H,1H3,(H,22,27)(H,28,29,30)(H,31,32,33)(H,23,24,25,26);;/q;2*+1/p-2 |
| InChIKey | KDVRYKWAQCWBTE-UHFFFAOYSA-L |
| XLogP | -3.13 |
| TPSA | 194.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.36 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|