C16H21N7O12S3 — CID 58925111
2-[1-hydroperoxyethenyl-[4-[2-(methanesulfonamido)ethylamino]-6-[5-sulfo-2-(trioxidanylsulfanyl)anilino]-1,3,5-triazin-2-yl]amino]acetic acid (PubChem CID 58925111) has the molecular formula C16H21N7O12S3 and a molecular weight of 599.58 g/mol. Its IUPAC name is 2-[1-hydroperoxyethenyl-[4-[2-(methanesulfonamido)ethylamino]-6-[5-sulfo-2-(trioxidanylsulfanyl)anilino]-1,3,5-triazin-2-yl]amino]acetic acid.
| Compound Name | 2-[1-hydroperoxyethenyl-[4-[2-(methanesulfonamido)ethylamino]-6-[5-sulfo-2-(trioxidanylsulfanyl)anilino]-1,3,5-triazin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 58925111 |
| Molecular Formula | C16H21N7O12S3 |
| Molecular Weight | 599.58 g/mol |
| Exact Mass | 599.04 |
| IUPAC Name | 2-[1-hydroperoxyethenyl-[4-[2-(methanesulfonamido)ethylamino]-6-[5-sulfo-2-(trioxidanylsulfanyl)anilino]-1,3,5-triazin-2-yl]amino]acetic acid |
| SMILES | C=C(OO)N(CC(=O)O)c1nc(NCCNS(C)(=O)=O)nc(Nc2cc(S(=O)(=O)O)ccc2SOOO)n1 |
| InChI | InChI=1S/C16H21N7O12S3/c1-9(33-26)23(8-13(24)25)16-21-14(17-5-6-18-37(2,28)29)20-15(22-16)19-11-7-10(38(30,31)32)3-4-12(11)36-35-34-27/h3-4,7,18,26-27H,1,5-6,8H2,2H3,(H,24,25)(H,30,31,32)(H2,17,19,20,21,22) |
| InChIKey | DMFUTSKMEGQHIN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 271.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.58 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|