C14H21N7O8S3 — CID 160922014
[2-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-methoxysulfonylphenyl]methanesulfonic acid (PubChem CID 160922014) has the molecular formula C14H21N7O8S3 and a molecular weight of 511.56 g/mol. Its IUPAC name is [2-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-methoxysulfonylphenyl]methanesulfonic acid.
| Compound Name | [2-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-methoxysulfonylphenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 160922014 |
| Molecular Formula | C14H21N7O8S3 |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | [2-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-methoxysulfonylphenyl]methanesulfonic acid |
| SMILES | COS(=O)(=O)c1ccc(CS(=O)(=O)O)c(Nc2nc(N)nc(NCCNS(C)(=O)=O)n2)c1 |
| InChI | InChI=1S/C14H21N7O8S3/c1-29-32(27,28)10-4-3-9(8-31(24,25)26)11(7-10)18-14-20-12(15)19-13(21-14)16-5-6-17-30(2,22)23/h3-4,7,17H,5-6,8H2,1-2H3,(H,24,25,26)(H4,15,16,18,19,20,21) |
| InChIKey | HLRRXENMMXGFCB-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 232.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|