C15H22N6O5S2 — CID 163626070
3-[[6-(dimethylamino)-2-[2-(methanesulfonamido)ethylamino]pyrimidin-4-yl]amino]benzenesulfonic acid (PubChem CID 163626070) has the molecular formula C15H22N6O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-[[6-(dimethylamino)-2-[2-(methanesulfonamido)ethylamino]pyrimidin-4-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[6-(dimethylamino)-2-[2-(methanesulfonamido)ethylamino]pyrimidin-4-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 163626070 |
| Molecular Formula | C15H22N6O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-[[6-(dimethylamino)-2-[2-(methanesulfonamido)ethylamino]pyrimidin-4-yl]amino]benzenesulfonic acid |
| SMILES | CN(C)c1cc(Nc2cccc(S(=O)(=O)O)c2)nc(NCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C15H22N6O5S2/c1-21(2)14-10-13(18-11-5-4-6-12(9-11)28(24,25)26)19-15(20-14)16-7-8-17-27(3,22)23/h4-6,9-10,17H,7-8H2,1-3H3,(H,24,25,26)(H2,16,18,19,20) |
| InChIKey | UNMRKTOISJRFDM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|