C19H28N4O7S3 — CID 157285281
3-[[4,6-bis(4-methylsulfonylbutyl)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 157285281) has the molecular formula C19H28N4O7S3 and a molecular weight of 520.66 g/mol. Its IUPAC name is 3-[[4,6-bis(4-methylsulfonylbutyl)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4,6-bis(4-methylsulfonylbutyl)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 157285281 |
| Molecular Formula | C19H28N4O7S3 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 3-[[4,6-bis(4-methylsulfonylbutyl)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | CS(=O)(=O)CCCCc1nc(CCCCS(C)(=O)=O)nc(Nc2cccc(S(=O)(=O)O)c2)n1 |
| InChI | InChI=1S/C19H28N4O7S3/c1-31(24,25)12-5-3-10-17-21-18(11-4-6-13-32(2,26)27)23-19(22-17)20-15-8-7-9-16(14-15)33(28,29)30/h7-9,14H,3-6,10-13H2,1-2H3,(H,28,29,30)(H,20,21,22,23) |
| InChIKey | FHLJPRIBPHMVEE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|