C15H12ClN5O4S — CID 57035254
3-[[4-(5-chloro-2-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 57035254) has the molecular formula C15H12ClN5O4S and a molecular weight of 393.81 g/mol. Its IUPAC name is 3-[[4-(5-chloro-2-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4-(5-chloro-2-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 57035254 |
| Molecular Formula | C15H12ClN5O4S |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 3-[[4-(5-chloro-2-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(Nc2ncnc(Nc3cc(Cl)ccc3O)n2)c1 |
| InChI | InChI=1S/C15H12ClN5O4S/c16-9-4-5-13(22)12(6-9)20-15-18-8-17-14(21-15)19-10-2-1-3-11(7-10)26(23,24)25/h1-8,22H,(H,23,24,25)(H2,17,18,19,20,21) |
| InChIKey | YIYVKJNZYYLBJG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|