C31H22N6O7S — CID 58716243
6-[[4-[(6-carboxynaphthalen-2-yl)amino]-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]naphthalene-2-carboxylic acid (PubChem CID 58716243) has the molecular formula C31H22N6O7S and a molecular weight of 622.62 g/mol. Its IUPAC name is 6-[[4-[(6-carboxynaphthalen-2-yl)amino]-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]naphthalene-2-carboxylic acid.
| Compound Name | 6-[[4-[(6-carboxynaphthalen-2-yl)amino]-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 58716243 |
| Molecular Formula | C31H22N6O7S |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | 6-[[4-[(6-carboxynaphthalen-2-yl)amino]-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc(Nc3nc(Nc4cccc(S(=O)(=O)O)c4)nc(Nc4ccc5cc(C(=O)O)ccc5c4)n3)ccc2c1 |
| InChI | InChI=1S/C31H22N6O7S/c38-27(39)21-6-4-19-14-24(10-8-17(19)12-21)33-30-35-29(32-23-2-1-3-26(16-23)45(42,43)44)36-31(37-30)34-25-11-9-18-13-22(28(40)41)7-5-20(18)15-25/h1-16H,(H,38,39)(H,40,41)(H,42,43,44)(H3,32,33,34,35,36,37) |
| InChIKey | DIVACWZKVBDZPB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 203.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|