C26H24N10O3S — CID 21351802
3,5-bis[(4-anilino-6-methyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid (PubChem CID 21351802) has the molecular formula C26H24N10O3S and a molecular weight of 556.61 g/mol. Its IUPAC name is 3,5-bis[(4-anilino-6-methyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 3,5-bis[(4-anilino-6-methyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 21351802 |
| Molecular Formula | C26H24N10O3S |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 3,5-bis[(4-anilino-6-methyl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
| SMILES | Cc1nc(Nc2ccccc2)nc(Nc2cc(Nc3nc(C)nc(Nc4ccccc4)n3)cc(S(=O)(=O)O)c2)n1 |
| InChI | InChI=1S/C26H24N10O3S/c1-16-27-23(31-18-9-5-3-6-10-18)35-25(29-16)33-20-13-21(15-22(14-20)40(37,38)39)34-26-30-17(2)28-24(36-26)32-19-11-7-4-8-12-19/h3-15H,1-2H3,(H,37,38,39)(H2,27,29,31,33,35)(H2,28,30,32,34,36) |
| InChIKey | CJRPZLCMBZVWAH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 179.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|