C12H13N3O — CID 45097442
2-anilino-4,6-dimethylpyrimidin-5-ol (PubChem CID 45097442) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-anilino-4,6-dimethylpyrimidin-5-ol.
| Compound Name | 2-anilino-4,6-dimethylpyrimidin-5-ol |
|---|---|
| PubChem CID | 45097442 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-anilino-4,6-dimethylpyrimidin-5-ol |
| SMILES | Cc1nc(Nc2ccccc2)nc(C)c1O |
| InChI | InChI=1S/C12H13N3O/c1-8-11(16)9(2)14-12(13-8)15-10-6-4-3-5-7-10/h3-7,16H,1-2H3,(H,13,14,15) |
| InChIKey | YZWHZRWOWLGVQA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |