C13H12FN3 — CID 20585932
4-ethenyl-5-fluoro-6-methyl-N-phenylpyrimidin-2-amine (PubChem CID 20585932) has the molecular formula C13H12FN3 and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-ethenyl-5-fluoro-6-methyl-N-phenylpyrimidin-2-amine.
| Compound Name | 4-ethenyl-5-fluoro-6-methyl-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 20585932 |
| Molecular Formula | C13H12FN3 |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-ethenyl-5-fluoro-6-methyl-N-phenylpyrimidin-2-amine |
| SMILES | C=Cc1nc(Nc2ccccc2)nc(C)c1F |
| InChI | InChI=1S/C13H12FN3/c1-3-11-12(14)9(2)15-13(17-11)16-10-7-5-4-6-8-10/h3-8H,1H2,2H3,(H,15,16,17) |
| InChIKey | FHIOPFLAUADTGI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |