C17H19N3O — CID 16583938
2-anilino-4,7,7-trimethyl-6,8-dihydroquinazolin-5-one (PubChem CID 16583938) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-anilino-4,7,7-trimethyl-6,8-dihydroquinazolin-5-one.
| Compound Name | 2-anilino-4,7,7-trimethyl-6,8-dihydroquinazolin-5-one |
|---|---|
| PubChem CID | 16583938 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-anilino-4,7,7-trimethyl-6,8-dihydroquinazolin-5-one |
| SMILES | Cc1nc(Nc2ccccc2)nc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C17H19N3O/c1-11-15-13(9-17(2,3)10-14(15)21)20-16(18-11)19-12-7-5-4-6-8-12/h4-8H,9-10H2,1-3H3,(H,18,19,20) |
| InChIKey | QXRUJLGSPRMUPO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |