C24H26N4O3 — CID 17198365
2,4-bis(4-methoxyanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one (PubChem CID 17198365) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2,4-bis(4-methoxyanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
| Compound Name | 2,4-bis(4-methoxyanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
|---|---|
| PubChem CID | 17198365 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2,4-bis(4-methoxyanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| SMILES | COc1ccc(Nc2nc3c(c(Nc4ccc(OC)cc4)n2)C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-24(2)13-19-21(20(29)14-24)22(25-15-5-9-17(30-3)10-6-15)28-23(27-19)26-16-7-11-18(31-4)12-8-16/h5-12H,13-14H2,1-4H3,(H2,25,26,27,28) |
| InChIKey | RBXMXLNXKQYZRW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |