C24H20F6N4O — CID 30320686
7,7-dimethyl-2,4-bis[3-(trifluoromethyl)anilino]-6,8-dihydroquinazolin-5-one (PubChem CID 30320686) has the molecular formula C24H20F6N4O and a molecular weight of 494.44 g/mol. Its IUPAC name is 7,7-dimethyl-2,4-bis[3-(trifluoromethyl)anilino]-6,8-dihydroquinazolin-5-one.
| Compound Name | 7,7-dimethyl-2,4-bis[3-(trifluoromethyl)anilino]-6,8-dihydroquinazolin-5-one |
|---|---|
| PubChem CID | 30320686 |
| Molecular Formula | C24H20F6N4O |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 7,7-dimethyl-2,4-bis[3-(trifluoromethyl)anilino]-6,8-dihydroquinazolin-5-one |
| SMILES | CC1(C)CC(=O)c2c(nc(Nc3cccc(C(F)(F)F)c3)nc2Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C24H20F6N4O/c1-22(2)11-17-19(18(35)12-22)20(31-15-7-3-5-13(9-15)23(25,26)27)34-21(33-17)32-16-8-4-6-14(10-16)24(28,29)30/h3-10H,11-12H2,1-2H3,(H2,31,32,33,34) |
| InChIKey | AUKKJQSZMLVUBU-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |