C23H16F6N4 — CID 5053700
6-methyl-2-N,3-N-bis[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine (PubChem CID 5053700) has the molecular formula C23H16F6N4 and a molecular weight of 462.40 g/mol. Its IUPAC name is 6-methyl-2-N,3-N-bis[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine.
| Compound Name | 6-methyl-2-N,3-N-bis[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 5053700 |
| Molecular Formula | C23H16F6N4 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 6-methyl-2-N,3-N-bis[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine |
| SMILES | Cc1ccc2nc(Nc3cccc(C(F)(F)F)c3)c(Nc3cccc(C(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C23H16F6N4/c1-13-8-9-18-19(10-13)33-21(31-17-7-3-5-15(12-17)23(27,28)29)20(32-18)30-16-6-2-4-14(11-16)22(24,25)26/h2-12H,1H3,(H,30,32)(H,31,33) |
| InChIKey | RBDKMTANTAOVSE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |