C27H12F6N6 — CID 126608669
16-methyl-6,27-bis(trifluoromethyl)-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4(9),5,7,10,12,14(19),15,17,20,22,24(29),25,27-pentadecaene (PubChem CID 126608669) has the molecular formula C27H12F6N6 and a molecular weight of 534.42 g/mol. Its IUPAC name is 16-methyl-6,27-bis(trifluoromethyl)-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4(9),5,7,10,12,14(19),15,17,20,22,24(29),25,27-pentadecaene.
| Compound Name | 16-methyl-6,27-bis(trifluoromethyl)-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4(9),5,7,10,12,14(19),15,17,20,22,24(29),25,27-pentadecaene |
|---|---|
| PubChem CID | 126608669 |
| Molecular Formula | C27H12F6N6 |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 16-methyl-6,27-bis(trifluoromethyl)-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4(9),5,7,10,12,14(19),15,17,20,22,24(29),25,27-pentadecaene |
| SMILES | Cc1ccc2nc3c4nc5ccc(C(F)(F)F)cc5nc4c4nc5cc(C(F)(F)F)ccc5nc4c3nc2c1 |
| InChI | InChI=1S/C27H12F6N6/c1-11-2-5-14-17(8-11)37-23-20(34-14)21-24(38-18-9-12(26(28,29)30)3-6-15(18)35-21)25-22(23)36-16-7-4-13(27(31,32)33)10-19(16)39-25/h2-10H,1H3 |
| InChIKey | PKNUSJOUNUOMAF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|