C15H10F3NS — CID 126550023
6-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazole (PubChem CID 126550023) has the molecular formula C15H10F3NS and a molecular weight of 293.31 g/mol. Its IUPAC name is 6-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazole.
| Compound Name | 6-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 126550023 |
| Molecular Formula | C15H10F3NS |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 6-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(-c3ccc(C(F)(F)F)cc3)sc2c1 |
| InChI | InChI=1S/C15H10F3NS/c1-9-2-7-12-13(8-9)20-14(19-12)10-3-5-11(6-4-10)15(16,17)18/h2-8H,1H3 |
| InChIKey | KSYRUGBGLVQXKC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |