C16H15F3N2S — CID 144945336
ethane;2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazol-6-amine (PubChem CID 144945336) has the molecular formula C16H15F3N2S and a molecular weight of 324.37 g/mol. Its IUPAC name is ethane;2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazol-6-amine.
| Compound Name | ethane;2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 144945336 |
| Molecular Formula | C16H15F3N2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | ethane;2-[4-(trifluoromethyl)phenyl]-1,3-benzothiazol-6-amine |
| SMILES | CC.Nc1ccc2nc(-c3ccc(C(F)(F)F)cc3)sc2c1 |
| InChI | InChI=1S/C14H9F3N2S.C2H6/c15-14(16,17)9-3-1-8(2-4-9)13-19-11-6-5-10(18)7-12(11)20-13;1-2/h1-7H,18H2;1-2H3 |
| InChIKey | WZZCPSFZJBNYKE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|