C13H5F5N2S — CID 66201699
2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzothiazol-6-amine (PubChem CID 66201699) has the molecular formula C13H5F5N2S and a molecular weight of 316.25 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 66201699 |
| Molecular Formula | C13H5F5N2S |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(-c3c(F)c(F)c(F)c(F)c3F)sc2c1 |
| InChI | InChI=1S/C13H5F5N2S/c14-8-7(9(15)11(17)12(18)10(8)16)13-20-5-2-1-4(19)3-6(5)21-13/h1-3H,19H2 |
| InChIKey | UFWRLMDHAMFJSA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|