C20H14N4S2 — CID 4649602
2-[2-(6-amino-1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazol-6-amine (PubChem CID 4649602) has the molecular formula C20H14N4S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[2-(6-amino-1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[2-(6-amino-1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 4649602 |
| Molecular Formula | C20H14N4S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[2-(6-amino-1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(-c3ccccc3-c3nc4ccc(N)cc4s3)sc2c1 |
| InChI | InChI=1S/C20H14N4S2/c21-11-5-7-15-17(9-11)25-19(23-15)13-3-1-2-4-14(13)20-24-16-8-6-12(22)10-18(16)26-20/h1-10H,21-22H2 |
| InChIKey | BGFNDIZHSWKAKW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|