About CID 143962463
CID 143962463 (PubChem CID 143962463) has the molecular formula C13H15N4PS3
and a molecular weight of 354.47 g/mol.
Molecular Properties
| Compound Name | CID 143962463 |
| PubChem CID | 143962463 |
| Molecular Formula | C13H15N4PS3 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | — |
| SMILES | NP.Nc1ccc2nc(-c3ccc(N)c(S)c3S)sc2c1 |
| InChI | InChI=1S/C13H11N3S3.H4NP/c14-6-1-4-9-10(5-6)19-13(16-9)7-2-3-8(15)12(18)11(7)17;1-2/h1-5,17-18H,14-15H2;1-2H2 |
| InChIKey | GTYWVWVBPJUBCX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 143962463 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143962463?
The IUPAC name of CID 143962463 (CID 143962463) is not available.
What is the SMILES notation for CID 143962463?
The canonical SMILES for CID 143962463 is NP.Nc1ccc2nc(-c3ccc(N)c(S)c3S)sc2c1.
What is the InChIKey of CID 143962463?
The InChIKey is GTYWVWVBPJUBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3S3.H4NP/c14-6-1-4-9-10(5-6)19-13(16-9)7-2-3-8(15)12(18)11(7)17;1-2/h1-5,17-18H,14-15H2;1-2H2.
What are the key properties of CID 143962463?
CID 143962463 has a molecular weight of 354.47 g/mol, XLogP of 3.44, 1 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143962463 is sourced from PubChem (CID 143962463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).