C14H14N4S — CID 104673194
2-(3-ethyl-6-methylpyridazin-4-yl)-1,3-benzothiazol-6-amine (PubChem CID 104673194) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(3-ethyl-6-methylpyridazin-4-yl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(3-ethyl-6-methylpyridazin-4-yl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 104673194 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(3-ethyl-6-methylpyridazin-4-yl)-1,3-benzothiazol-6-amine |
| SMILES | CCc1nnc(C)cc1-c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C14H14N4S/c1-3-11-10(6-8(2)17-18-11)14-16-12-5-4-9(15)7-13(12)19-14/h4-7H,3,15H2,1-2H3 |
| InChIKey | SQFKIIMXSZRCQL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|