C13H11N3O2S2 — CID 132544425
ethyl 2-(6-amino-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxylate (PubChem CID 132544425) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is ethyl 2-(6-amino-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(6-amino-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 132544425 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | ethyl 2-(6-amino-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2nc3ccc(N)cc3s2)n1 |
| InChI | InChI=1S/C13H11N3O2S2/c1-2-18-13(17)9-6-19-11(16-9)12-15-8-4-3-7(14)5-10(8)20-12/h3-6H,2,14H2,1H3 |
| InChIKey | BGUVJTHDCVMSKF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|