C9H8N2O2S2 — CID 59345227
ethyl 2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate (PubChem CID 59345227) has the molecular formula C9H8N2O2S2 and a molecular weight of 240.31 g/mol. Its IUPAC name is ethyl 2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59345227 |
| Molecular Formula | C9H8N2O2S2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | ethyl 2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2cscn2)n1 |
| InChI | InChI=1S/C9H8N2O2S2/c1-2-13-9(12)7-4-15-8(11-7)6-3-14-5-10-6/h3-5H,2H2,1H3 |
| InChIKey | XRCTYBZKBCPQHB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |